C22H34N2O5S — CID 70049982
N-(1-amino-1-oxohexan-2-yl)-2-benzyl-5-tert-butylsulfonyl-4-oxopentanamide (PubChem CID 70049982) has the molecular formula C22H34N2O5S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-(1-amino-1-oxohexan-2-yl)-2-benzyl-5-tert-butylsulfonyl-4-oxopentanamide.
| Compound Name | N-(1-amino-1-oxohexan-2-yl)-2-benzyl-5-tert-butylsulfonyl-4-oxopentanamide |
|---|---|
| PubChem CID | 70049982 |
| Molecular Formula | C22H34N2O5S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-(1-amino-1-oxohexan-2-yl)-2-benzyl-5-tert-butylsulfonyl-4-oxopentanamide |
| SMILES | CCCCC(NC(=O)C(CC(=O)CS(=O)(=O)C(C)(C)C)Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C22H34N2O5S/c1-5-6-12-19(20(23)26)24-21(27)17(13-16-10-8-7-9-11-16)14-18(25)15-30(28,29)22(2,3)4/h7-11,17,19H,5-6,12-15H2,1-4H3,(H2,23,26)(H,24,27) |
| InChIKey | DPDDIEQBGWJLIJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |