C17H28N2O2U — CID 58455901
2-(tert-butylamino)-1-[4-(hydroxyamino)phenyl]-4,4-dimethylpentan-3-one;uranium (PubChem CID 58455901) has the molecular formula C17H28N2O2U and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-[4-(hydroxyamino)phenyl]-4,4-dimethylpentan-3-one;uranium.
| Compound Name | 2-(tert-butylamino)-1-[4-(hydroxyamino)phenyl]-4,4-dimethylpentan-3-one;uranium |
|---|---|
| PubChem CID | 58455901 |
| Molecular Formula | C17H28N2O2U |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 2-(tert-butylamino)-1-[4-(hydroxyamino)phenyl]-4,4-dimethylpentan-3-one;uranium |
| SMILES | CC(C)(C)NC(Cc1ccc(NO)cc1)C(=O)C(C)(C)C.[U] |
| InChI | InChI=1S/C17H28N2O2.U/c1-16(2,3)15(20)14(18-17(4,5)6)11-12-7-9-13(19-21)10-8-12;/h7-10,14,18-19,21H,11H2,1-6H3; |
| InChIKey | ZMEDJQIELFMNOE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|