C19H29NO2 — CID 20821100
1-(4-acetylphenyl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one (PubChem CID 20821100) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(4-acetylphenyl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 20821100 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 1-(4-acetylphenyl)-2-(tert-butylamino)-4,4-dimethylpentan-3-one |
| SMILES | CC(=O)c1ccc(CC(NC(C)(C)C)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-13(21)15-10-8-14(9-11-15)12-16(20-19(5,6)7)17(22)18(2,3)4/h8-11,16,20H,12H2,1-7H3 |
| InChIKey | IIHMKPOUYGXNOQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |