C14H18O2 — CID 122675580
1-(4-acetylphenyl)-3,3-dimethylbutan-2-one (PubChem CID 122675580) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3,3-dimethylbutan-2-one.
| Compound Name | 1-(4-acetylphenyl)-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 122675580 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(4-acetylphenyl)-3,3-dimethylbutan-2-one |
| SMILES | CC(=O)c1ccc(CC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H18O2/c1-10(15)12-7-5-11(6-8-12)9-13(16)14(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | MSHMPDQPFSKURJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |