C18H28O3 — CID 153355329
[4-(3,3-dimethyl-2-oxobutyl)phenyl] 2-methylpropanoate;ethane (PubChem CID 153355329) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [4-(3,3-dimethyl-2-oxobutyl)phenyl] 2-methylpropanoate;ethane.
| Compound Name | [4-(3,3-dimethyl-2-oxobutyl)phenyl] 2-methylpropanoate;ethane |
|---|---|
| PubChem CID | 153355329 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [4-(3,3-dimethyl-2-oxobutyl)phenyl] 2-methylpropanoate;ethane |
| SMILES | CC.CC(C)C(=O)Oc1ccc(CC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22O3.C2H6/c1-11(2)15(18)19-13-8-6-12(7-9-13)10-14(17)16(3,4)5;1-2/h6-9,11H,10H2,1-5H3;1-2H3 |
| InChIKey | KOTWABAVEFTIDO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|