About (4-propanoylphenyl) 2-methylpropanoate
(4-propanoylphenyl) 2-methylpropanoate (PubChem CID 19170731) has the molecular formula C13H16O3
and a molecular weight of 220.27 g/mol. Its IUPAC name is (4-propanoylphenyl) 2-methylpropanoate.
Molecular Properties
| Compound Name | (4-propanoylphenyl) 2-methylpropanoate |
| PubChem CID | 19170731 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (4-propanoylphenyl) 2-methylpropanoate |
| SMILES | CCC(=O)c1ccc(OC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C13H16O3/c1-4-12(14)10-5-7-11(8-6-10)16-13(15)9(2)3/h5-9H,4H2,1-3H3 |
| InChIKey | UMAUVBCEKPPATG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-propanoylphenyl) 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propanoylphenyl) 2-methylpropanoate?
The IUPAC name of (4-propanoylphenyl) 2-methylpropanoate (CID 19170731) is (4-propanoylphenyl) 2-methylpropanoate.
What is the SMILES notation for (4-propanoylphenyl) 2-methylpropanoate?
The canonical SMILES for (4-propanoylphenyl) 2-methylpropanoate is CCC(=O)c1ccc(OC(=O)C(C)C)cc1.
What is the InChIKey of (4-propanoylphenyl) 2-methylpropanoate?
The InChIKey is UMAUVBCEKPPATG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-4-12(14)10-5-7-11(8-6-10)16-13(15)9(2)3/h5-9H,4H2,1-3H3.
What are the key properties of (4-propanoylphenyl) 2-methylpropanoate?
(4-propanoylphenyl) 2-methylpropanoate has a molecular weight of 220.27 g/mol, XLogP of 2.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propanoylphenyl) 2-methylpropanoate is sourced from PubChem (CID 19170731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).