About propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate
propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate (PubChem CID 58331813) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate.
Analyze propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate?
The IUPAC name of propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate (CID 58331813) is propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate.
What is the SMILES notation for propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate?
The canonical SMILES for propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate is CC(C)OC(=O)NC(C(=O)C(C)(C)C)C(C)(C)C.
What is the InChIKey of propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate?
The InChIKey is WUADTFNOEZOZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-9(2)18-12(17)15-10(13(3,4)5)11(16)14(6,7)8/h9-10H,1-8H3,(H,15,17).
What are the key properties of propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate?
propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate has a molecular weight of 257.37 g/mol, XLogP of 3.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-(2,2,5,5-tetramethyl-4-oxohexan-3-yl)carbamate is sourced from PubChem (CID 58331813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).