C8H19NOS — CID 160564575
(4S)-2,2-dimethyl-4-(methylamino)pentan-3-one;sulfane (PubChem CID 160564575) has the molecular formula C8H19NOS and a molecular weight of 177.31 g/mol. Its IUPAC name is (4S)-2,2-dimethyl-4-(methylamino)pentan-3-one;sulfane.
| Compound Name | (4S)-2,2-dimethyl-4-(methylamino)pentan-3-one;sulfane |
|---|---|
| PubChem CID | 160564575 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4S)-2,2-dimethyl-4-(methylamino)pentan-3-one;sulfane |
| SMILES | CN[C@@H](C)C(=O)C(C)(C)C.S |
| InChI | InChI=1S/C8H17NO.H2S/c1-6(9-5)7(10)8(2,3)4;/h6,9H,1-5H3;1H2/t6-;/m0./s1 |
| InChIKey | QZTDXRRMAIFOKG-RGMNGODLSA-N |
| XLogP | 1.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |