C11H23N3O2 — CID 129026706
1-(4,4-dimethyl-3-oxopentan-2-yl)-3-[2-(methylamino)ethyl]urea (PubChem CID 129026706) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-(4,4-dimethyl-3-oxopentan-2-yl)-3-[2-(methylamino)ethyl]urea.
| Compound Name | 1-(4,4-dimethyl-3-oxopentan-2-yl)-3-[2-(methylamino)ethyl]urea |
|---|---|
| PubChem CID | 129026706 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 1-(4,4-dimethyl-3-oxopentan-2-yl)-3-[2-(methylamino)ethyl]urea |
| SMILES | CNCCNC(=O)NC(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23N3O2/c1-8(9(15)11(2,3)4)14-10(16)13-7-6-12-5/h8,12H,6-7H2,1-5H3,(H2,13,14,16) |
| InChIKey | IDQJTMWHIUIROB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|