C10H21NO — CID 158863781
(3R)-4,4-dimethyl-3-(propan-2-ylamino)pentan-2-one (PubChem CID 158863781) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (3R)-4,4-dimethyl-3-(propan-2-ylamino)pentan-2-one.
| Compound Name | (3R)-4,4-dimethyl-3-(propan-2-ylamino)pentan-2-one |
|---|---|
| PubChem CID | 158863781 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3R)-4,4-dimethyl-3-(propan-2-ylamino)pentan-2-one |
| SMILES | CC(=O)[C@H](NC(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H21NO/c1-7(2)11-9(8(3)12)10(4,5)6/h7,9,11H,1-6H3/t9-/m0/s1 |
| InChIKey | BWTIXYWIAJGPBD-VIFPVBQESA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |