C16H33NO2 — CID 143418595
N-(2,2-dimethyl-4-oxopentan-3-yl)-3-ethylpentanamide;ethane (PubChem CID 143418595) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is N-(2,2-dimethyl-4-oxopentan-3-yl)-3-ethylpentanamide;ethane.
| Compound Name | N-(2,2-dimethyl-4-oxopentan-3-yl)-3-ethylpentanamide;ethane |
|---|---|
| PubChem CID | 143418595 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | N-(2,2-dimethyl-4-oxopentan-3-yl)-3-ethylpentanamide;ethane |
| SMILES | CC.CCC(CC)CC(=O)NC(C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NO2.C2H6/c1-7-11(8-2)9-12(17)15-13(10(3)16)14(4,5)6;1-2/h11,13H,7-9H2,1-6H3,(H,15,17);1-2H3 |
| InChIKey | ZBRRQAHLIOHZLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |