C15H32N2O2 — CID 143418948
1-cyclopropyl-3-(2,2-dimethyl-4-oxopentan-3-yl)urea;ethane (PubChem CID 143418948) has the molecular formula C15H32N2O2 and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2,2-dimethyl-4-oxopentan-3-yl)urea;ethane.
| Compound Name | 1-cyclopropyl-3-(2,2-dimethyl-4-oxopentan-3-yl)urea;ethane |
|---|---|
| PubChem CID | 143418948 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1-cyclopropyl-3-(2,2-dimethyl-4-oxopentan-3-yl)urea;ethane |
| SMILES | CC.CC.CC(=O)C(NC(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O2.2C2H6/c1-7(14)9(11(2,3)4)13-10(15)12-8-5-6-8;2*1-2/h8-9H,5-6H2,1-4H3,(H2,12,13,15);2*1-2H3 |
| InChIKey | SGISDPGSOJXMLM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |