C16H30N2O2 — CID 143418831
1-cyclohexyl-3-(2,2,5-trimethyl-4-oxohexan-3-yl)urea (PubChem CID 143418831) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,2,5-trimethyl-4-oxohexan-3-yl)urea.
| Compound Name | 1-cyclohexyl-3-(2,2,5-trimethyl-4-oxohexan-3-yl)urea |
|---|---|
| PubChem CID | 143418831 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1-cyclohexyl-3-(2,2,5-trimethyl-4-oxohexan-3-yl)urea |
| SMILES | CC(C)C(=O)C(NC(=O)NC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C16H30N2O2/c1-11(2)13(19)14(16(3,4)5)18-15(20)17-12-9-7-6-8-10-12/h11-12,14H,6-10H2,1-5H3,(H2,17,18,20) |
| InChIKey | FOQRRQVSFDUJRI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |