C12H26N2O — CID 104828170
3-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)pentanamide (PubChem CID 104828170) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)pentanamide.
| Compound Name | 3-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)pentanamide |
|---|---|
| PubChem CID | 104828170 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3-(aminomethyl)-N-(3,3-dimethylbutan-2-yl)pentanamide |
| SMILES | CCC(CN)CC(=O)NC(C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2O/c1-6-10(8-13)7-11(15)14-9(2)12(3,4)5/h9-10H,6-8,13H2,1-5H3,(H,14,15) |
| InChIKey | YMSGYBFCSMJWIA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |