About 4-amino-2,2,6-trimethylnonan-3-one;ethane
4-amino-2,2,6-trimethylnonan-3-one;ethane (PubChem CID 142239507) has the molecular formula C14H31NO
and a molecular weight of 229.41 g/mol. Its IUPAC name is 4-amino-2,2,6-trimethylnonan-3-one;ethane.
Molecular Properties
| Compound Name | 4-amino-2,2,6-trimethylnonan-3-one;ethane |
| PubChem CID | 142239507 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 4-amino-2,2,6-trimethylnonan-3-one;ethane |
| SMILES | CC.CCCC(C)CC(N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H25NO.C2H6/c1-6-7-9(2)8-10(13)11(14)12(3,4)5;1-2/h9-10H,6-8,13H2,1-5H3;1-2H3 |
| InChIKey | BZSLGAJLQGTLGR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-2,2,6-trimethylnonan-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2,6-trimethylnonan-3-one;ethane?
The IUPAC name of 4-amino-2,2,6-trimethylnonan-3-one;ethane (CID 142239507) is 4-amino-2,2,6-trimethylnonan-3-one;ethane.
What is the SMILES notation for 4-amino-2,2,6-trimethylnonan-3-one;ethane?
The canonical SMILES for 4-amino-2,2,6-trimethylnonan-3-one;ethane is CC.CCCC(C)CC(N)C(=O)C(C)(C)C.
What is the InChIKey of 4-amino-2,2,6-trimethylnonan-3-one;ethane?
The InChIKey is BZSLGAJLQGTLGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.C2H6/c1-6-7-9(2)8-10(13)11(14)12(3,4)5;1-2/h9-10H,6-8,13H2,1-5H3;1-2H3.
What are the key properties of 4-amino-2,2,6-trimethylnonan-3-one;ethane?
4-amino-2,2,6-trimethylnonan-3-one;ethane has a molecular weight of 229.41 g/mol, XLogP of 3.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2,6-trimethylnonan-3-one;ethane is sourced from PubChem (CID 142239507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).