C12H15F2NO — CID 58998587
(2S)-1-(3,5-difluorophenyl)-2-(methylamino)pentan-3-one (PubChem CID 58998587) has the molecular formula C12H15F2NO and a molecular weight of 227.25 g/mol. Its IUPAC name is (2S)-1-(3,5-difluorophenyl)-2-(methylamino)pentan-3-one.
| Compound Name | (2S)-1-(3,5-difluorophenyl)-2-(methylamino)pentan-3-one |
|---|---|
| PubChem CID | 58998587 |
| Molecular Formula | C12H15F2NO |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (2S)-1-(3,5-difluorophenyl)-2-(methylamino)pentan-3-one |
| SMILES | CCC(=O)[C@H](Cc1cc(F)cc(F)c1)NC |
| InChI | InChI=1S/C12H15F2NO/c1-3-12(16)11(15-2)6-8-4-9(13)7-10(14)5-8/h4-5,7,11,15H,3,6H2,1-2H3/t11-/m0/s1 |
| InChIKey | BVGJQFQUJIAYER-NSHDSACASA-N |
| XLogP | 2.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |