C7H4BrClF2O — CID 162422497
(3-bromo-4-chloro-2,6-difluorophenyl)methanol (PubChem CID 162422497) has the molecular formula C7H4BrClF2O and a molecular weight of 257.46 g/mol. Its IUPAC name is (3-bromo-4-chloro-2,6-difluorophenyl)methanol.
| Compound Name | (3-bromo-4-chloro-2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 162422497 |
| Molecular Formula | C7H4BrClF2O |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 255.91 |
| IUPAC Name | (3-bromo-4-chloro-2,6-difluorophenyl)methanol |
| SMILES | OCc1c(F)cc(Cl)c(Br)c1F |
| InChI | InChI=1S/C7H4BrClF2O/c8-6-4(9)1-5(10)3(2-12)7(6)11/h1,12H,2H2 |
| InChIKey | CAMRCTGLKYAQDY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|