C24H28OSi2 — CID 174060733
[3,6-bis(2-trimethylsilylethynyl)-9H-fluoren-1-yl]methanol (PubChem CID 174060733) has the molecular formula C24H28OSi2 and a molecular weight of 388.66 g/mol. Its IUPAC name is [3,6-bis(2-trimethylsilylethynyl)-9H-fluoren-1-yl]methanol.
| Compound Name | [3,6-bis(2-trimethylsilylethynyl)-9H-fluoren-1-yl]methanol |
|---|---|
| PubChem CID | 174060733 |
| Molecular Formula | C24H28OSi2 |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [3,6-bis(2-trimethylsilylethynyl)-9H-fluoren-1-yl]methanol |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)-c1cc(C#C[Si](C)(C)C)cc(CO)c1C2 |
| InChI | InChI=1S/C24H28OSi2/c1-26(2,3)11-9-18-7-8-20-16-23-21(17-25)13-19(10-12-27(4,5)6)15-24(23)22(20)14-18/h7-8,13-15,25H,16-17H2,1-6H3 |
| InChIKey | AWNFZSMUDCRFKA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|