C11H13FN2 — CID 162381509
1-ethyl-6-fluoro-2,5-dimethylbenzimidazole (PubChem CID 162381509) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 1-ethyl-6-fluoro-2,5-dimethylbenzimidazole.
| Compound Name | 1-ethyl-6-fluoro-2,5-dimethylbenzimidazole |
|---|---|
| PubChem CID | 162381509 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1-ethyl-6-fluoro-2,5-dimethylbenzimidazole |
| SMILES | CCn1c(C)nc2cc(C)c(F)cc21 |
| InChI | InChI=1S/C11H13FN2/c1-4-14-8(3)13-10-5-7(2)9(12)6-11(10)14/h5-6H,4H2,1-3H3 |
| InChIKey | SHOJPLCQBDQAPS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |