C10H11FN2 — CID 123239325
6-fluoro-1,2,5-trimethylbenzimidazole (PubChem CID 123239325) has the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. Its IUPAC name is 6-fluoro-1,2,5-trimethylbenzimidazole.
| Compound Name | 6-fluoro-1,2,5-trimethylbenzimidazole |
|---|---|
| PubChem CID | 123239325 |
| Molecular Formula | C10H11FN2 |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 6-fluoro-1,2,5-trimethylbenzimidazole |
| SMILES | Cc1cc2nc(C)n(C)c2cc1F |
| InChI | InChI=1S/C10H11FN2/c1-6-4-9-10(5-8(6)11)13(3)7(2)12-9/h4-5H,1-3H3 |
| InChIKey | YLOXDADHENVMNV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |