C12H18N2O — CID 168977189
ethane;2,3,6-trimethylbenzimidazol-5-ol (PubChem CID 168977189) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is ethane;2,3,6-trimethylbenzimidazol-5-ol.
| Compound Name | ethane;2,3,6-trimethylbenzimidazol-5-ol |
|---|---|
| PubChem CID | 168977189 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | ethane;2,3,6-trimethylbenzimidazol-5-ol |
| SMILES | CC.Cc1cc2nc(C)n(C)c2cc1O |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-6-4-8-9(5-10(6)13)12(3)7(2)11-8;1-2/h4-5,13H,1-3H3;1-2H3 |
| InChIKey | GDVXBDVAHPYNCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |