C15H20ClN3 — CID 86596193
6,7-dimethyl-5,7,13-triazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;hydrochloride (PubChem CID 86596193) has the molecular formula C15H20ClN3 and a molecular weight of 277.80 g/mol. Its IUPAC name is 6,7-dimethyl-5,7,13-triazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;hydrochloride.
| Compound Name | 6,7-dimethyl-5,7,13-triazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;hydrochloride |
|---|---|
| PubChem CID | 86596193 |
| Molecular Formula | C15H20ClN3 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 6,7-dimethyl-5,7,13-triazatetracyclo[9.3.2.02,10.04,8]hexadeca-2,4(8),5,9-tetraene;hydrochloride |
| SMILES | Cc1nc2cc3c(cc2n1C)C1CCC3CNC1.Cl |
| InChI | InChI=1S/C15H19N3.ClH/c1-9-17-14-5-12-10-3-4-11(8-16-7-10)13(12)6-15(14)18(9)2;/h5-6,10-11,16H,3-4,7-8H2,1-2H3;1H |
| InChIKey | RPJPJGFMXFNRLS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |