C13H16N4 — CID 23572275
2-ethyl-1,6,7-trimethylimidazo[4,5-f]benzimidazole (PubChem CID 23572275) has the molecular formula C13H16N4 and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-ethyl-1,6,7-trimethylimidazo[4,5-f]benzimidazole.
| Compound Name | 2-ethyl-1,6,7-trimethylimidazo[4,5-f]benzimidazole |
|---|---|
| PubChem CID | 23572275 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-ethyl-1,6,7-trimethylimidazo[4,5-f]benzimidazole |
| SMILES | CCc1nc2cc3nc(C)n(C)c3cc2n1C |
| InChI | InChI=1S/C13H16N4/c1-5-13-15-10-6-9-11(7-12(10)17(13)4)16(3)8(2)14-9/h6-7H,5H2,1-4H3 |
| InChIKey | ISZUWXSZKXBYRG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |