C11H11ClN2O — CID 83890942
1-(6-chloro-1,2-dimethylbenzimidazol-5-yl)ethanone (PubChem CID 83890942) has the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. Its IUPAC name is 1-(6-chloro-1,2-dimethylbenzimidazol-5-yl)ethanone.
| Compound Name | 1-(6-chloro-1,2-dimethylbenzimidazol-5-yl)ethanone |
|---|---|
| PubChem CID | 83890942 |
| Molecular Formula | C11H11ClN2O |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-(6-chloro-1,2-dimethylbenzimidazol-5-yl)ethanone |
| SMILES | CC(=O)c1cc2nc(C)n(C)c2cc1Cl |
| InChI | InChI=1S/C11H11ClN2O/c1-6(15)8-4-10-11(5-9(8)12)14(3)7(2)13-10/h4-5H,1-3H3 |
| InChIKey | LWZCRGKQKWMJRB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |