C10H9F2N3S — CID 82149925
2-(5,6-difluoro-2-methylbenzimidazol-1-yl)ethanethioamide (PubChem CID 82149925) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2-(5,6-difluoro-2-methylbenzimidazol-1-yl)ethanethioamide.
| Compound Name | 2-(5,6-difluoro-2-methylbenzimidazol-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 82149925 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2-(5,6-difluoro-2-methylbenzimidazol-1-yl)ethanethioamide |
| SMILES | Cc1nc2cc(F)c(F)cc2n1CC(N)=S |
| InChI | InChI=1S/C10H9F2N3S/c1-5-14-8-2-6(11)7(12)3-9(8)15(5)4-10(13)16/h2-3H,4H2,1H3,(H2,13,16) |
| InChIKey | MXGQKGHSWWZDDJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|