C18H19N3O2S — CID 39158035
2-[5,6-dimethoxy-2-(4-methylphenyl)benzimidazol-1-yl]ethanethioamide (PubChem CID 39158035) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is 2-[5,6-dimethoxy-2-(4-methylphenyl)benzimidazol-1-yl]ethanethioamide.
| Compound Name | 2-[5,6-dimethoxy-2-(4-methylphenyl)benzimidazol-1-yl]ethanethioamide |
|---|---|
| PubChem CID | 39158035 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[5,6-dimethoxy-2-(4-methylphenyl)benzimidazol-1-yl]ethanethioamide |
| SMILES | COc1cc2nc(-c3ccc(C)cc3)n(CC(N)=S)c2cc1OC |
| InChI | InChI=1S/C18H19N3O2S/c1-11-4-6-12(7-5-11)18-20-13-8-15(22-2)16(23-3)9-14(13)21(18)10-17(19)24/h4-9H,10H2,1-3H3,(H2,19,24) |
| InChIKey | WNMMACIQVGIUDT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|