C13H16ClN3O3 — CID 83008544
2-[2-(2-chloroethyl)-5,6-dimethoxybenzimidazol-1-yl]acetamide (PubChem CID 83008544) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-[2-(2-chloroethyl)-5,6-dimethoxybenzimidazol-1-yl]acetamide.
| Compound Name | 2-[2-(2-chloroethyl)-5,6-dimethoxybenzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 83008544 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[2-(2-chloroethyl)-5,6-dimethoxybenzimidazol-1-yl]acetamide |
| SMILES | COc1cc2nc(CCCl)n(CC(N)=O)c2cc1OC |
| InChI | InChI=1S/C13H16ClN3O3/c1-19-10-5-8-9(6-11(10)20-2)17(7-12(15)18)13(16-8)3-4-14/h5-6H,3-4,7H2,1-2H3,(H2,15,18) |
| InChIKey | XAOUJJDJMMZLLY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|