C21H35N3O2 — CID 92636108
10-(1-ethyl-5,6-dimethoxybenzimidazol-2-yl)decan-1-amine (PubChem CID 92636108) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is 10-(1-ethyl-5,6-dimethoxybenzimidazol-2-yl)decan-1-amine.
| Compound Name | 10-(1-ethyl-5,6-dimethoxybenzimidazol-2-yl)decan-1-amine |
|---|---|
| PubChem CID | 92636108 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | 10-(1-ethyl-5,6-dimethoxybenzimidazol-2-yl)decan-1-amine |
| SMILES | CCn1c(CCCCCCCCCCN)nc2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C21H35N3O2/c1-4-24-18-16-20(26-3)19(25-2)15-17(18)23-21(24)13-11-9-7-5-6-8-10-12-14-22/h15-16H,4-14,22H2,1-3H3 |
| InChIKey | OBHQXGIZGCIEGU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|