C21H32N4 — CID 92635833
2-[2-(10-aminodecyl)-5,6-dimethylbenzimidazol-1-yl]acetonitrile (PubChem CID 92635833) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 2-[2-(10-aminodecyl)-5,6-dimethylbenzimidazol-1-yl]acetonitrile.
| Compound Name | 2-[2-(10-aminodecyl)-5,6-dimethylbenzimidazol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 92635833 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-[2-(10-aminodecyl)-5,6-dimethylbenzimidazol-1-yl]acetonitrile |
| SMILES | Cc1cc2nc(CCCCCCCCCCN)n(CC#N)c2cc1C |
| InChI | InChI=1S/C21H32N4/c1-17-15-19-20(16-18(17)2)25(14-13-23)21(24-19)11-9-7-5-3-4-6-8-10-12-22/h15-16H,3-12,14,22H2,1-2H3 |
| InChIKey | OYPWCTBKNZGOTA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|