C16H23ClN2O2 — CID 83003668
2-(2-chloroethyl)-5,6-dimethoxy-1-(3-methylbutan-2-yl)benzimidazole (PubChem CID 83003668) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5,6-dimethoxy-1-(3-methylbutan-2-yl)benzimidazole.
| Compound Name | 2-(2-chloroethyl)-5,6-dimethoxy-1-(3-methylbutan-2-yl)benzimidazole |
|---|---|
| PubChem CID | 83003668 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(2-chloroethyl)-5,6-dimethoxy-1-(3-methylbutan-2-yl)benzimidazole |
| SMILES | COc1cc2nc(CCCl)n(C(C)C(C)C)c2cc1OC |
| InChI | InChI=1S/C16H23ClN2O2/c1-10(2)11(3)19-13-9-15(21-5)14(20-4)8-12(13)18-16(19)6-7-17/h8-11H,6-7H2,1-5H3 |
| InChIKey | JINCZKUKJDZABO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|