C13H15Cl2N3S — CID 39158125
2-(2-butyl-5,6-dichlorobenzimidazol-1-yl)ethanethioamide (PubChem CID 39158125) has the molecular formula C13H15Cl2N3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-(2-butyl-5,6-dichlorobenzimidazol-1-yl)ethanethioamide.
| Compound Name | 2-(2-butyl-5,6-dichlorobenzimidazol-1-yl)ethanethioamide |
|---|---|
| PubChem CID | 39158125 |
| Molecular Formula | C13H15Cl2N3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 2-(2-butyl-5,6-dichlorobenzimidazol-1-yl)ethanethioamide |
| SMILES | CCCCc1nc2cc(Cl)c(Cl)cc2n1CC(N)=S |
| InChI | InChI=1S/C13H15Cl2N3S/c1-2-3-4-13-17-10-5-8(14)9(15)6-11(10)18(13)7-12(16)19/h5-6H,2-4,7H2,1H3,(H2,16,19) |
| InChIKey | WAQNDBXSPMYHCK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|