C11H8BrF3IN3 — CID 114261091
[8-bromo-5-iodo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 114261091) has the molecular formula C11H8BrF3IN3 and a molecular weight of 446.01 g/mol. Its IUPAC name is [8-bromo-5-iodo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
| Compound Name | [8-bromo-5-iodo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
|---|---|
| PubChem CID | 114261091 |
| Molecular Formula | C11H8BrF3IN3 |
| Molecular Weight | 446.01 g/mol |
| Exact Mass | 444.89 |
| IUPAC Name | [8-bromo-5-iodo-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | Cc1c(C(F)(F)F)nc2c(Br)ccc(I)c2c1NN |
| InChI | InChI=1S/C11H8BrF3IN3/c1-4-8(19-17)7-6(16)3-2-5(12)9(7)18-10(4)11(13,14)15/h2-3H,17H2,1H3,(H,18,19) |
| InChIKey | GCPMBBRMHHMTIB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.01 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|