C12H11Cl2N — CID 104722009
4,7-dichloro-2,3,6-trimethylquinoline (PubChem CID 104722009) has the molecular formula C12H11Cl2N and a molecular weight of 240.13 g/mol. Its IUPAC name is 4,7-dichloro-2,3,6-trimethylquinoline.
| Compound Name | 4,7-dichloro-2,3,6-trimethylquinoline |
|---|---|
| PubChem CID | 104722009 |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4,7-dichloro-2,3,6-trimethylquinoline |
| SMILES | Cc1cc2c(Cl)c(C)c(C)nc2cc1Cl |
| InChI | InChI=1S/C12H11Cl2N/c1-6-4-9-11(5-10(6)13)15-8(3)7(2)12(9)14/h4-5H,1-3H3 |
| InChIKey | DLJUSLUPURJHJT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |