C12H11ClFNO — CID 103996653
4-chloro-7-fluoro-6-methoxy-2,3-dimethylquinoline (PubChem CID 103996653) has the molecular formula C12H11ClFNO and a molecular weight of 239.68 g/mol. Its IUPAC name is 4-chloro-7-fluoro-6-methoxy-2,3-dimethylquinoline.
| Compound Name | 4-chloro-7-fluoro-6-methoxy-2,3-dimethylquinoline |
|---|---|
| PubChem CID | 103996653 |
| Molecular Formula | C12H11ClFNO |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 4-chloro-7-fluoro-6-methoxy-2,3-dimethylquinoline |
| SMILES | COc1cc2c(Cl)c(C)c(C)nc2cc1F |
| InChI | InChI=1S/C12H11ClFNO/c1-6-7(2)15-10-5-9(14)11(16-3)4-8(10)12(6)13/h4-5H,1-3H3 |
| InChIKey | CLJWOCNJRTYEGK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |