C23H14ClF4NO — CID 170432061
4-chloro-6-fluoro-7-methoxy-2-methyl-3-[4-(2,3,4-trifluorophenyl)phenyl]quinoline (PubChem CID 170432061) has the molecular formula C23H14ClF4NO and a molecular weight of 431.82 g/mol. Its IUPAC name is 4-chloro-6-fluoro-7-methoxy-2-methyl-3-[4-(2,3,4-trifluorophenyl)phenyl]quinoline.
| Compound Name | 4-chloro-6-fluoro-7-methoxy-2-methyl-3-[4-(2,3,4-trifluorophenyl)phenyl]quinoline |
|---|---|
| PubChem CID | 170432061 |
| Molecular Formula | C23H14ClF4NO |
| Molecular Weight | 431.82 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 4-chloro-6-fluoro-7-methoxy-2-methyl-3-[4-(2,3,4-trifluorophenyl)phenyl]quinoline |
| SMILES | COc1cc2nc(C)c(-c3ccc(-c4ccc(F)c(F)c4F)cc3)c(Cl)c2cc1F |
| InChI | InChI=1S/C23H14ClF4NO/c1-11-20(21(24)15-9-17(26)19(30-2)10-18(15)29-11)13-5-3-12(4-6-13)14-7-8-16(25)23(28)22(14)27/h3-10H,1-2H3 |
| InChIKey | ZOXGPAQBSRXNOX-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.82 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|