C15H17ClN2 — CID 63180046
4-chloro-2,3-dimethyl-6-pyrrolidin-1-ylquinoline (PubChem CID 63180046) has the molecular formula C15H17ClN2 and a molecular weight of 260.77 g/mol. Its IUPAC name is 4-chloro-2,3-dimethyl-6-pyrrolidin-1-ylquinoline.
| Compound Name | 4-chloro-2,3-dimethyl-6-pyrrolidin-1-ylquinoline |
|---|---|
| PubChem CID | 63180046 |
| Molecular Formula | C15H17ClN2 |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-chloro-2,3-dimethyl-6-pyrrolidin-1-ylquinoline |
| SMILES | Cc1nc2ccc(N3CCCC3)cc2c(Cl)c1C |
| InChI | InChI=1S/C15H17ClN2/c1-10-11(2)17-14-6-5-12(9-13(14)15(10)16)18-7-3-4-8-18/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | CKLLOBYCXKYODA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |