C11H10ClFN2 — CID 107531295
8-chloro-5-fluoro-N,2-dimethylquinolin-4-amine (PubChem CID 107531295) has the molecular formula C11H10ClFN2 and a molecular weight of 224.67 g/mol. Its IUPAC name is 8-chloro-5-fluoro-N,2-dimethylquinolin-4-amine.
| Compound Name | 8-chloro-5-fluoro-N,2-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 107531295 |
| Molecular Formula | C11H10ClFN2 |
| Molecular Weight | 224.67 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 8-chloro-5-fluoro-N,2-dimethylquinolin-4-amine |
| SMILES | CNc1cc(C)nc2c(Cl)ccc(F)c12 |
| InChI | InChI=1S/C11H10ClFN2/c1-6-5-9(14-2)10-8(13)4-3-7(12)11(10)15-6/h3-5H,1-2H3,(H,14,15) |
| InChIKey | WNDHUFOHVRGZJV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |