C13H14Br2N2O — CID 103416775
6,8-dibromo-3-ethyl-5-methoxy-2-methylquinolin-4-amine (PubChem CID 103416775) has the molecular formula C13H14Br2N2O and a molecular weight of 374.08 g/mol. Its IUPAC name is 6,8-dibromo-3-ethyl-5-methoxy-2-methylquinolin-4-amine.
| Compound Name | 6,8-dibromo-3-ethyl-5-methoxy-2-methylquinolin-4-amine |
|---|---|
| PubChem CID | 103416775 |
| Molecular Formula | C13H14Br2N2O |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 371.95 |
| IUPAC Name | 6,8-dibromo-3-ethyl-5-methoxy-2-methylquinolin-4-amine |
| SMILES | CCc1c(C)nc2c(Br)cc(Br)c(OC)c2c1N |
| InChI | InChI=1S/C13H14Br2N2O/c1-4-7-6(2)17-12-8(14)5-9(15)13(18-3)10(12)11(7)16/h5H,4H2,1-3H3,(H2,16,17) |
| InChIKey | SKRXIBYBFBOSNC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |