C15H22N2 — CID 142091780
ethane;N-ethyl-2,3-dimethylquinolin-4-amine (PubChem CID 142091780) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is ethane;N-ethyl-2,3-dimethylquinolin-4-amine.
| Compound Name | ethane;N-ethyl-2,3-dimethylquinolin-4-amine |
|---|---|
| PubChem CID | 142091780 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | ethane;N-ethyl-2,3-dimethylquinolin-4-amine |
| SMILES | CC.CCNc1c(C)c(C)nc2ccccc12 |
| InChI | InChI=1S/C13H16N2.C2H6/c1-4-14-13-9(2)10(3)15-12-8-6-5-7-11(12)13;1-2/h5-8H,4H2,1-3H3,(H,14,15);1-2H3 |
| InChIKey | HHQCPZOGWPYNLN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |