About 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline
4-chloro-7,8-difluoro-3-iodo-2-methylquinoline (PubChem CID 121236852) has the molecular formula C10H5ClF2IN
and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline.
Molecular Properties
| Compound Name | 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline |
| PubChem CID | 121236852 |
| Molecular Formula | C10H5ClF2IN |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 338.91 |
| IUPAC Name | 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline |
| SMILES | Cc1nc2c(F)c(F)ccc2c(Cl)c1I |
| InChI | InChI=1S/C10H5ClF2IN/c1-4-9(14)7(11)5-2-3-6(12)8(13)10(5)15-4/h2-3H,1H3 |
| InChIKey | QMMWQSKIRJKNOU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline?
The IUPAC name of 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline (CID 121236852) is 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline.
What is the SMILES notation for 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline?
The canonical SMILES for 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline is Cc1nc2c(F)c(F)ccc2c(Cl)c1I.
What is the InChIKey of 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline?
The InChIKey is QMMWQSKIRJKNOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5ClF2IN/c1-4-9(14)7(11)5-2-3-6(12)8(13)10(5)15-4/h2-3H,1H3.
What are the key properties of 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline?
4-chloro-7,8-difluoro-3-iodo-2-methylquinoline has a molecular weight of 339.51 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-7,8-difluoro-3-iodo-2-methylquinoline is sourced from PubChem (CID 121236852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).