C12H8Cl2F3NO — CID 63744411
4,8-dichloro-5-methoxy-3-methyl-2-(trifluoromethyl)quinoline (PubChem CID 63744411) has the molecular formula C12H8Cl2F3NO and a molecular weight of 310.10 g/mol. Its IUPAC name is 4,8-dichloro-5-methoxy-3-methyl-2-(trifluoromethyl)quinoline.
| Compound Name | 4,8-dichloro-5-methoxy-3-methyl-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 63744411 |
| Molecular Formula | C12H8Cl2F3NO |
| Molecular Weight | 310.10 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 4,8-dichloro-5-methoxy-3-methyl-2-(trifluoromethyl)quinoline |
| SMILES | COc1ccc(Cl)c2nc(C(F)(F)F)c(C)c(Cl)c12 |
| InChI | InChI=1S/C12H8Cl2F3NO/c1-5-9(14)8-7(19-2)4-3-6(13)10(8)18-11(5)12(15,16)17/h3-4H,1-2H3 |
| InChIKey | HGRULMUKZAXTAN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.10 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |