C18H11ClO4 — CID 146018204
11-chloro-1-hydroxy-12-methoxynaphtho[1,2-c]isochromen-6-one (PubChem CID 146018204) has the molecular formula C18H11ClO4 and a molecular weight of 326.74 g/mol. Its IUPAC name is 11-chloro-1-hydroxy-12-methoxynaphtho[1,2-c]isochromen-6-one.
| Compound Name | 11-chloro-1-hydroxy-12-methoxynaphtho[1,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 146018204 |
| Molecular Formula | C18H11ClO4 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 11-chloro-1-hydroxy-12-methoxynaphtho[1,2-c]isochromen-6-one |
| SMILES | COc1c(Cl)c2c3ccccc3c(=O)oc2c2cccc(O)c12 |
| InChI | InChI=1S/C18H11ClO4/c1-22-17-13-11(7-4-8-12(13)20)16-14(15(17)19)9-5-2-3-6-10(9)18(21)23-16/h2-8,20H,1H3 |
| InChIKey | VPRHIPQILPTIBC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|