C20H14O6 — CID 71485237
1-hydroxy-10,12-dimethoxy-6-oxonaphtho[1,2-c]isochromene-8-carbaldehyde (PubChem CID 71485237) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is 1-hydroxy-10,12-dimethoxy-6-oxonaphtho[1,2-c]isochromene-8-carbaldehyde.
| Compound Name | 1-hydroxy-10,12-dimethoxy-6-oxonaphtho[1,2-c]isochromene-8-carbaldehyde |
|---|---|
| PubChem CID | 71485237 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 1-hydroxy-10,12-dimethoxy-6-oxonaphtho[1,2-c]isochromene-8-carbaldehyde |
| SMILES | COc1cc2c(oc(=O)c3cc(C=O)cc(OC)c32)c2cccc(O)c12 |
| InChI | InChI=1S/C20H14O6/c1-24-15-7-10(9-21)6-13-17(15)12-8-16(25-2)18-11(4-3-5-14(18)22)19(12)26-20(13)23/h3-9,22H,1-2H3 |
| InChIKey | QLELAEWJHLXWEZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|