C15H12O4 — CID 23559359
4,6-dimethoxydibenzofuran-2-carbaldehyde (PubChem CID 23559359) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 4,6-dimethoxydibenzofuran-2-carbaldehyde.
| Compound Name | 4,6-dimethoxydibenzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 23559359 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 4,6-dimethoxydibenzofuran-2-carbaldehyde |
| SMILES | COc1cccc2c1oc1c(OC)cc(C=O)cc12 |
| InChI | InChI=1S/C15H12O4/c1-17-12-5-3-4-10-11-6-9(8-16)7-13(18-2)15(11)19-14(10)12/h3-8H,1-2H3 |
| InChIKey | UNLHLGYSJKVCBT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|