C31H33NO8 — CID 139664401
1-[3-(dimethylamino)propanoyl]-8-ethenyl-10-methoxy-12-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]naphtho[1,2-c]isochromen-6-one (PubChem CID 139664401) has the molecular formula C31H33NO8 and a molecular weight of 547.60 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propanoyl]-8-ethenyl-10-methoxy-12-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]naphtho[1,2-c]isochromen-6-one.
| Compound Name | 1-[3-(dimethylamino)propanoyl]-8-ethenyl-10-methoxy-12-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]naphtho[1,2-c]isochromen-6-one |
|---|---|
| PubChem CID | 139664401 |
| Molecular Formula | C31H33NO8 |
| Molecular Weight | 547.60 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[3-(dimethylamino)propanoyl]-8-ethenyl-10-methoxy-12-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]naphtho[1,2-c]isochromen-6-one |
| SMILES | C=Cc1cc(OC)c2c(c1)c(=O)oc1c3cccc(C(=O)CCN(C)C)c3c([C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)cc12 |
| InChI | InChI=1S/C31H33NO8/c1-6-16-12-21-25(23(13-16)38-5)20-14-19(30-28(36)27(35)26(34)15(2)39-30)24-17(22(33)10-11-32(3)4)8-7-9-18(24)29(20)40-31(21)37/h6-9,12-15,26-28,30,34-36H,1,10-11H2,2-5H3/t15-,26-,27+,28+,30-/m0/s1 |
| InChIKey | PFCPUVWXJDBZFQ-CPOPHLCXSA-N |
| XLogP | 3.43 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|