C31H33NO10 — CID 163053711
[4-(dimethylamino)-5-hydroxy-6-[1-hydroxy-10,12-dimethoxy-8-(oxiran-2-yl)-6-oxonaphtho[1,2-c]isochromen-4-yl]-2-methyloxan-3-yl] acetate (PubChem CID 163053711) has the molecular formula C31H33NO10 and a molecular weight of 579.60 g/mol. Its IUPAC name is [4-(dimethylamino)-5-hydroxy-6-[1-hydroxy-10,12-dimethoxy-8-(oxiran-2-yl)-6-oxonaphtho[1,2-c]isochromen-4-yl]-2-methyloxan-3-yl] acetate.
| Compound Name | [4-(dimethylamino)-5-hydroxy-6-[1-hydroxy-10,12-dimethoxy-8-(oxiran-2-yl)-6-oxonaphtho[1,2-c]isochromen-4-yl]-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 163053711 |
| Molecular Formula | C31H33NO10 |
| Molecular Weight | 579.60 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | [4-(dimethylamino)-5-hydroxy-6-[1-hydroxy-10,12-dimethoxy-8-(oxiran-2-yl)-6-oxonaphtho[1,2-c]isochromen-4-yl]-2-methyloxan-3-yl] acetate |
| SMILES | COc1cc2c(oc(=O)c3cc(C4CO4)cc(OC)c32)c2c(C3OC(C)C(OC(C)=O)C(N(C)C)C3O)ccc(O)c12 |
| InChI | InChI=1S/C31H33NO10/c1-13-28(41-14(2)33)26(32(3)4)27(35)30(40-13)16-7-8-19(34)25-21(38-6)11-17-23-18(31(36)42-29(17)24(16)25)9-15(22-12-39-22)10-20(23)37-5/h7-11,13,22,26-28,30,34-35H,12H2,1-6H3 |
| InChIKey | UNHWULHGNFYLGN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 140.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|