C12H17NO5 — CID 134894740
(3-amino-2,4,6-trimethoxyphenyl)methyl acetate (PubChem CID 134894740) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (3-amino-2,4,6-trimethoxyphenyl)methyl acetate.
| Compound Name | (3-amino-2,4,6-trimethoxyphenyl)methyl acetate |
|---|---|
| PubChem CID | 134894740 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (3-amino-2,4,6-trimethoxyphenyl)methyl acetate |
| SMILES | COc1cc(OC)c(COC(C)=O)c(OC)c1N |
| InChI | InChI=1S/C12H17NO5/c1-7(14)18-6-8-9(15-2)5-10(16-3)11(13)12(8)17-4/h5H,6,13H2,1-4H3 |
| InChIKey | RAABJMYNPOJQLU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|