C29H26O4 — CID 174564849
[3-(2,3-diphenylphenyl)-2,6-dimethoxyphenyl]methyl acetate (PubChem CID 174564849) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is [3-(2,3-diphenylphenyl)-2,6-dimethoxyphenyl]methyl acetate.
| Compound Name | [3-(2,3-diphenylphenyl)-2,6-dimethoxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 174564849 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | [3-(2,3-diphenylphenyl)-2,6-dimethoxyphenyl]methyl acetate |
| SMILES | COc1ccc(-c2cccc(-c3ccccc3)c2-c2ccccc2)c(OC)c1COC(C)=O |
| InChI | InChI=1S/C29H26O4/c1-20(30)33-19-26-27(31-2)18-17-25(29(26)32-3)24-16-10-15-23(21-11-6-4-7-12-21)28(24)22-13-8-5-9-14-22/h4-18H,19H2,1-3H3 |
| InChIKey | JQDRIZLSHFTBEC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |