C21H22O3 — CID 147832089
3-(2-methoxy-4-pentylphenyl)chromen-2-one (PubChem CID 147832089) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-(2-methoxy-4-pentylphenyl)chromen-2-one.
| Compound Name | 3-(2-methoxy-4-pentylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 147832089 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 3-(2-methoxy-4-pentylphenyl)chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccccc3oc2=O)c(OC)c1 |
| InChI | InChI=1S/C21H22O3/c1-3-4-5-8-15-11-12-17(20(13-15)23-2)18-14-16-9-6-7-10-19(16)24-21(18)22/h6-7,9-14H,3-5,8H2,1-2H3 |
| InChIKey | SKOZRXQKYFUETB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|