C26H24F8N2O6 — CID 162608969
[2-[[[2-[1-[(2S)-butan-2-yl]-2-pyridin-3-ylindol-6-yl]oxy-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate (PubChem CID 162608969) has the molecular formula C26H24F8N2O6 and a molecular weight of 612.47 g/mol. Its IUPAC name is [2-[[[2-[1-[(2S)-butan-2-yl]-2-pyridin-3-ylindol-6-yl]oxy-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate.
| Compound Name | [2-[[[2-[1-[(2S)-butan-2-yl]-2-pyridin-3-ylindol-6-yl]oxy-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate |
|---|---|
| PubChem CID | 162608969 |
| Molecular Formula | C26H24F8N2O6 |
| Molecular Weight | 612.47 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | [2-[[[2-[1-[(2S)-butan-2-yl]-2-pyridin-3-ylindol-6-yl]oxy-1,1-difluoroethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)COc1ccc2cc(-c3cccnc3)n([C@@H](C)CC)c2c1 |
| InChI | InChI=1S/C26H24F8N2O6/c1-4-16(3)36-20(18-7-6-10-35-13-18)11-17-8-9-19(12-21(17)36)38-14-23(27,28)40-25(31,32)42-26(33,34)41-24(29,30)15-39-22(37)5-2/h5-13,16H,2,4,14-15H2,1,3H3/t16-/m0/s1 |
| InChIKey | HGVIOVUQQMFCNU-INIZCTEOSA-N |
| XLogP | 7.12 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|